C18H16N2OS3 — CID 18076603
1-(4-methylphenyl)-2-[(4-phenyl-5-sulfanylidene-1,3,4-thiadiazol-2-yl)sulfanyl]propan-1-one (PubChem CID 18076603) has the molecular formula C18H16N2OS3 and a molecular weight of 372.54 g/mol. Its IUPAC name is 1-(4-methylphenyl)-2-[(4-phenyl-5-sulfanylidene-1,3,4-thiadiazol-2-yl)sulfanyl]propan-1-one.
| Compound Name | 1-(4-methylphenyl)-2-[(4-phenyl-5-sulfanylidene-1,3,4-thiadiazol-2-yl)sulfanyl]propan-1-one |
|---|---|
| PubChem CID | 18076603 |
| Molecular Formula | C18H16N2OS3 |
| Molecular Weight | 372.54 g/mol |
| Exact Mass | 372.04 |
| IUPAC Name | 1-(4-methylphenyl)-2-[(4-phenyl-5-sulfanylidene-1,3,4-thiadiazol-2-yl)sulfanyl]propan-1-one |
| SMILES | Cc1ccc(C(=O)C(C)Sc2nn(-c3ccccc3)c(=S)s2)cc1 |
| InChI | InChI=1S/C18H16N2OS3/c1-12-8-10-14(11-9-12)16(21)13(2)23-17-19-20(18(22)24-17)15-6-4-3-5-7-15/h3-11,13H,1-2H3 |
| InChIKey | PXMHCAHQIXMFCI-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.54 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|