C15H14N4O2S3 — CID 51307138
N-(3-methyl-1,2-oxazol-5-yl)-2-[(4-phenyl-5-sulfanylidene-1,3,4-thiadiazol-2-yl)sulfanyl]propanamide (PubChem CID 51307138) has the molecular formula C15H14N4O2S3 and a molecular weight of 378.50 g/mol. Its IUPAC name is N-(3-methyl-1,2-oxazol-5-yl)-2-[(4-phenyl-5-sulfanylidene-1,3,4-thiadiazol-2-yl)sulfanyl]propanamide.
| Compound Name | N-(3-methyl-1,2-oxazol-5-yl)-2-[(4-phenyl-5-sulfanylidene-1,3,4-thiadiazol-2-yl)sulfanyl]propanamide |
|---|---|
| PubChem CID | 51307138 |
| Molecular Formula | C15H14N4O2S3 |
| Molecular Weight | 378.50 g/mol |
| Exact Mass | 378.03 |
| IUPAC Name | N-(3-methyl-1,2-oxazol-5-yl)-2-[(4-phenyl-5-sulfanylidene-1,3,4-thiadiazol-2-yl)sulfanyl]propanamide |
| SMILES | Cc1cc(NC(=O)C(C)Sc2nn(-c3ccccc3)c(=S)s2)on1 |
| InChI | InChI=1S/C15H14N4O2S3/c1-9-8-12(21-18-9)16-13(20)10(2)23-14-17-19(15(22)24-14)11-6-4-3-5-7-11/h3-8,10H,1-2H3,(H,16,20) |
| InChIKey | XZHMRDNAYUXEEH-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 72.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.50 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|