C18H15F2N3O2S3 — CID 46620415
N-[2-(difluoromethoxy)phenyl]-2-[(4-phenyl-5-sulfanylidene-1,3,4-thiadiazol-2-yl)sulfanyl]propanamide (PubChem CID 46620415) has the molecular formula C18H15F2N3O2S3 and a molecular weight of 439.53 g/mol. Its IUPAC name is N-[2-(difluoromethoxy)phenyl]-2-[(4-phenyl-5-sulfanylidene-1,3,4-thiadiazol-2-yl)sulfanyl]propanamide.
| Compound Name | N-[2-(difluoromethoxy)phenyl]-2-[(4-phenyl-5-sulfanylidene-1,3,4-thiadiazol-2-yl)sulfanyl]propanamide |
|---|---|
| PubChem CID | 46620415 |
| Molecular Formula | C18H15F2N3O2S3 |
| Molecular Weight | 439.53 g/mol |
| Exact Mass | 439.03 |
| IUPAC Name | N-[2-(difluoromethoxy)phenyl]-2-[(4-phenyl-5-sulfanylidene-1,3,4-thiadiazol-2-yl)sulfanyl]propanamide |
| SMILES | CC(Sc1nn(-c2ccccc2)c(=S)s1)C(=O)Nc1ccccc1OC(F)F |
| InChI | InChI=1S/C18H15F2N3O2S3/c1-11(15(24)21-13-9-5-6-10-14(13)25-16(19)20)27-17-22-23(18(26)28-17)12-7-3-2-4-8-12/h2-11,16H,1H3,(H,21,24) |
| InChIKey | RAPRNTGLTLPWRG-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.53 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|