C19H19N3OS3 — CID 17403660
N-(4-ethylphenyl)-2-[(4-phenyl-5-sulfanylidene-1,3,4-thiadiazol-2-yl)sulfanyl]propanamide (PubChem CID 17403660) has the molecular formula C19H19N3OS3 and a molecular weight of 401.58 g/mol. Its IUPAC name is N-(4-ethylphenyl)-2-[(4-phenyl-5-sulfanylidene-1,3,4-thiadiazol-2-yl)sulfanyl]propanamide.
| Compound Name | N-(4-ethylphenyl)-2-[(4-phenyl-5-sulfanylidene-1,3,4-thiadiazol-2-yl)sulfanyl]propanamide |
|---|---|
| PubChem CID | 17403660 |
| Molecular Formula | C19H19N3OS3 |
| Molecular Weight | 401.58 g/mol |
| Exact Mass | 401.07 |
| IUPAC Name | N-(4-ethylphenyl)-2-[(4-phenyl-5-sulfanylidene-1,3,4-thiadiazol-2-yl)sulfanyl]propanamide |
| SMILES | CCc1ccc(NC(=O)C(C)Sc2nn(-c3ccccc3)c(=S)s2)cc1 |
| InChI | InChI=1S/C19H19N3OS3/c1-3-14-9-11-15(12-10-14)20-17(23)13(2)25-18-21-22(19(24)26-18)16-7-5-4-6-8-16/h4-13H,3H2,1-2H3,(H,20,23) |
| InChIKey | WXOPXRJYQIYSOC-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.58 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|