C21H27NO3S — CID 94027359
(2S)-N-(4-butylphenyl)-2-(3,4-dimethoxyphenyl)sulfanylpropanamide (PubChem CID 94027359) has the molecular formula C21H27NO3S and a molecular weight of 373.52 g/mol. Its IUPAC name is (2S)-N-(4-butylphenyl)-2-(3,4-dimethoxyphenyl)sulfanylpropanamide.
| Compound Name | (2S)-N-(4-butylphenyl)-2-(3,4-dimethoxyphenyl)sulfanylpropanamide |
|---|---|
| PubChem CID | 94027359 |
| Molecular Formula | C21H27NO3S |
| Molecular Weight | 373.52 g/mol |
| Exact Mass | 373.17 |
| IUPAC Name | (2S)-N-(4-butylphenyl)-2-(3,4-dimethoxyphenyl)sulfanylpropanamide |
| SMILES | CCCCc1ccc(NC(=O)[C@H](C)Sc2ccc(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C21H27NO3S/c1-5-6-7-16-8-10-17(11-9-16)22-21(23)15(2)26-18-12-13-19(24-3)20(14-18)25-4/h8-15H,5-7H2,1-4H3,(H,22,23)/t15-/m0/s1 |
| InChIKey | QFGABLMNRQOLLT-HNNXBMFYSA-N |
| XLogP | 5.17 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.52 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |