C21H28N2O5S2 — CID 43875866
N-[4-(diethylsulfamoyl)phenyl]-2-(3,4-dimethoxyphenyl)sulfanylpropanamide (PubChem CID 43875866) has the molecular formula C21H28N2O5S2 and a molecular weight of 452.60 g/mol. Its IUPAC name is N-[4-(diethylsulfamoyl)phenyl]-2-(3,4-dimethoxyphenyl)sulfanylpropanamide.
| Compound Name | N-[4-(diethylsulfamoyl)phenyl]-2-(3,4-dimethoxyphenyl)sulfanylpropanamide |
|---|---|
| PubChem CID | 43875866 |
| Molecular Formula | C21H28N2O5S2 |
| Molecular Weight | 452.60 g/mol |
| Exact Mass | 452.14 |
| IUPAC Name | N-[4-(diethylsulfamoyl)phenyl]-2-(3,4-dimethoxyphenyl)sulfanylpropanamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(NC(=O)C(C)Sc2ccc(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C21H28N2O5S2/c1-6-23(7-2)30(25,26)18-11-8-16(9-12-18)22-21(24)15(3)29-17-10-13-19(27-4)20(14-17)28-5/h8-15H,6-7H2,1-5H3,(H,22,24) |
| InChIKey | QJJPGCNXPLYAMJ-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.60 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |