C19H21NO4S — CID 30400035
(2R)-N-(3-acetylphenyl)-2-(3,4-dimethoxyphenyl)sulfanylpropanamide (PubChem CID 30400035) has the molecular formula C19H21NO4S and a molecular weight of 359.45 g/mol. Its IUPAC name is (2R)-N-(3-acetylphenyl)-2-(3,4-dimethoxyphenyl)sulfanylpropanamide.
| Compound Name | (2R)-N-(3-acetylphenyl)-2-(3,4-dimethoxyphenyl)sulfanylpropanamide |
|---|---|
| PubChem CID | 30400035 |
| Molecular Formula | C19H21NO4S |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.12 |
| IUPAC Name | (2R)-N-(3-acetylphenyl)-2-(3,4-dimethoxyphenyl)sulfanylpropanamide |
| SMILES | COc1ccc(S[C@H](C)C(=O)Nc2cccc(C(C)=O)c2)cc1OC |
| InChI | InChI=1S/C19H21NO4S/c1-12(21)14-6-5-7-15(10-14)20-19(22)13(2)25-16-8-9-17(23-3)18(11-16)24-4/h5-11,13H,1-4H3,(H,20,22)/t13-/m1/s1 |
| InChIKey | DVVNVMLQLASSEL-CYBMUJFWSA-N |
| XLogP | 4.03 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |