C21H21NO3S — CID 94019708
(2S)-2-(3,4-dimethoxyphenyl)sulfanyl-N-naphthalen-1-ylpropanamide (PubChem CID 94019708) has the molecular formula C21H21NO3S and a molecular weight of 367.47 g/mol. Its IUPAC name is (2S)-2-(3,4-dimethoxyphenyl)sulfanyl-N-naphthalen-1-ylpropanamide.
| Compound Name | (2S)-2-(3,4-dimethoxyphenyl)sulfanyl-N-naphthalen-1-ylpropanamide |
|---|---|
| PubChem CID | 94019708 |
| Molecular Formula | C21H21NO3S |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | (2S)-2-(3,4-dimethoxyphenyl)sulfanyl-N-naphthalen-1-ylpropanamide |
| SMILES | COc1ccc(S[C@@H](C)C(=O)Nc2cccc3ccccc23)cc1OC |
| InChI | InChI=1S/C21H21NO3S/c1-14(26-16-11-12-19(24-2)20(13-16)25-3)21(23)22-18-10-6-8-15-7-4-5-9-17(15)18/h4-14H,1-3H3,(H,22,23)/t14-/m0/s1 |
| InChIKey | XBUXGUWADSVIAN-AWEZNQCLSA-N |
| XLogP | 4.98 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |