C18H20N2O4S — CID 99956454
2-[[(2S)-2-(3,4-dimethoxyphenyl)sulfanylpropanoyl]amino]benzamide (PubChem CID 99956454) has the molecular formula C18H20N2O4S and a molecular weight of 360.44 g/mol. Its IUPAC name is 2-[[(2S)-2-(3,4-dimethoxyphenyl)sulfanylpropanoyl]amino]benzamide.
| Compound Name | 2-[[(2S)-2-(3,4-dimethoxyphenyl)sulfanylpropanoyl]amino]benzamide |
|---|---|
| PubChem CID | 99956454 |
| Molecular Formula | C18H20N2O4S |
| Molecular Weight | 360.44 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | 2-[[(2S)-2-(3,4-dimethoxyphenyl)sulfanylpropanoyl]amino]benzamide |
| SMILES | COc1ccc(S[C@@H](C)C(=O)Nc2ccccc2C(N)=O)cc1OC |
| InChI | InChI=1S/C18H20N2O4S/c1-11(25-12-8-9-15(23-2)16(10-12)24-3)18(22)20-14-7-5-4-6-13(14)17(19)21/h4-11H,1-3H3,(H2,19,21)(H,20,22)/t11-/m0/s1 |
| InChIKey | ZMZQYCMBTDEDCM-NSHDSACASA-N |
| XLogP | 2.92 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.44 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |