C22H25N3O2S3 — CID 55375605
2-[(5-butylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]-N-(2-methoxy-5-methylphenyl)-2-phenylacetamide (PubChem CID 55375605) has the molecular formula C22H25N3O2S3 and a molecular weight of 459.66 g/mol. Its IUPAC name is 2-[(5-butylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]-N-(2-methoxy-5-methylphenyl)-2-phenylacetamide.
| Compound Name | 2-[(5-butylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]-N-(2-methoxy-5-methylphenyl)-2-phenylacetamide |
|---|---|
| PubChem CID | 55375605 |
| Molecular Formula | C22H25N3O2S3 |
| Molecular Weight | 459.66 g/mol |
| Exact Mass | 459.11 |
| IUPAC Name | 2-[(5-butylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]-N-(2-methoxy-5-methylphenyl)-2-phenylacetamide |
| SMILES | CCCCSc1nnc(SC(C(=O)Nc2cc(C)ccc2OC)c2ccccc2)s1 |
| InChI | InChI=1S/C22H25N3O2S3/c1-4-5-13-28-21-24-25-22(30-21)29-19(16-9-7-6-8-10-16)20(26)23-17-14-15(2)11-12-18(17)27-3/h6-12,14,19H,4-5,13H2,1-3H3,(H,23,26) |
| InChIKey | OUSHIVRLQHIYOW-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.66 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|