C13H14N4O3S2 — CID 7586966
(2R)-2-[[5-[(4-methylphenyl)carbamoylamino]-1,3,4-thiadiazol-2-yl]sulfanyl]propanoic acid (PubChem CID 7586966) has the molecular formula C13H14N4O3S2 and a molecular weight of 338.41 g/mol. Its IUPAC name is (2R)-2-[[5-[(4-methylphenyl)carbamoylamino]-1,3,4-thiadiazol-2-yl]sulfanyl]propanoic acid.
| Compound Name | (2R)-2-[[5-[(4-methylphenyl)carbamoylamino]-1,3,4-thiadiazol-2-yl]sulfanyl]propanoic acid |
|---|---|
| PubChem CID | 7586966 |
| Molecular Formula | C13H14N4O3S2 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.05 |
| IUPAC Name | (2R)-2-[[5-[(4-methylphenyl)carbamoylamino]-1,3,4-thiadiazol-2-yl]sulfanyl]propanoic acid |
| SMILES | Cc1ccc(NC(=O)Nc2nnc(S[C@H](C)C(=O)O)s2)cc1 |
| InChI | InChI=1S/C13H14N4O3S2/c1-7-3-5-9(6-4-7)14-11(20)15-12-16-17-13(22-12)21-8(2)10(18)19/h3-6,8H,1-2H3,(H,18,19)(H2,14,15,16,20)/t8-/m1/s1 |
| InChIKey | HTAMSMBNGYQZDC-MRVPVSSYSA-N |
| XLogP | 3.06 |
| TPSA | 104.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|