C12H10ClN4O3S2- — CID 7587542
(2R)-2-[[5-[(4-chlorophenyl)carbamoylamino]-1,3,4-thiadiazol-2-yl]sulfanyl]propanoate (PubChem CID 7587542) has the molecular formula C12H10ClN4O3S2- and a molecular weight of 357.82 g/mol. Its IUPAC name is (2R)-2-[[5-[(4-chlorophenyl)carbamoylamino]-1,3,4-thiadiazol-2-yl]sulfanyl]propanoate.
| Compound Name | (2R)-2-[[5-[(4-chlorophenyl)carbamoylamino]-1,3,4-thiadiazol-2-yl]sulfanyl]propanoate |
|---|---|
| PubChem CID | 7587542 |
| Molecular Formula | C12H10ClN4O3S2- |
| Molecular Weight | 357.82 g/mol |
| Exact Mass | 356.99 |
| IUPAC Name | (2R)-2-[[5-[(4-chlorophenyl)carbamoylamino]-1,3,4-thiadiazol-2-yl]sulfanyl]propanoate |
| SMILES | C[C@@H](Sc1nnc(NC(=O)Nc2ccc(Cl)cc2)s1)C(=O)[O-] |
| InChI | InChI=1S/C12H11ClN4O3S2/c1-6(9(18)19)21-12-17-16-11(22-12)15-10(20)14-8-4-2-7(13)3-5-8/h2-6H,1H3,(H,18,19)(H2,14,15,16,20)/p-1/t6-/m1/s1 |
| InChIKey | PGNIXFGDUXOAPE-ZCFIWIBFSA-M |
| XLogP | 2.07 |
| TPSA | 107.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.82 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|