C13H13ClN4O3S2 — CID 7587568
1-(4-chlorophenyl)-3-[5-(1,3-dioxolan-2-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]urea (PubChem CID 7587568) has the molecular formula C13H13ClN4O3S2 and a molecular weight of 372.86 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-[5-(1,3-dioxolan-2-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]urea.
| Compound Name | 1-(4-chlorophenyl)-3-[5-(1,3-dioxolan-2-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]urea |
|---|---|
| PubChem CID | 7587568 |
| Molecular Formula | C13H13ClN4O3S2 |
| Molecular Weight | 372.86 g/mol |
| Exact Mass | 372.01 |
| IUPAC Name | 1-(4-chlorophenyl)-3-[5-(1,3-dioxolan-2-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]urea |
| SMILES | O=C(Nc1ccc(Cl)cc1)Nc1nnc(SCC2OCCO2)s1 |
| InChI | InChI=1S/C13H13ClN4O3S2/c14-8-1-3-9(4-2-8)15-11(19)16-12-17-18-13(23-12)22-7-10-20-5-6-21-10/h1-4,10H,5-7H2,(H2,15,16,17,19) |
| InChIKey | KOJMXNKKXAXHNI-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.86 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|