C13H14ClN5OS — CID 22509963
1-(4-chlorophenyl)-3-(5-pyrrolidin-1-yl-1,3,4-thiadiazol-2-yl)urea (PubChem CID 22509963) has the molecular formula C13H14ClN5OS and a molecular weight of 323.81 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-(5-pyrrolidin-1-yl-1,3,4-thiadiazol-2-yl)urea.
| Compound Name | 1-(4-chlorophenyl)-3-(5-pyrrolidin-1-yl-1,3,4-thiadiazol-2-yl)urea |
|---|---|
| PubChem CID | 22509963 |
| Molecular Formula | C13H14ClN5OS |
| Molecular Weight | 323.81 g/mol |
| Exact Mass | 323.06 |
| IUPAC Name | 1-(4-chlorophenyl)-3-(5-pyrrolidin-1-yl-1,3,4-thiadiazol-2-yl)urea |
| SMILES | O=C(Nc1ccc(Cl)cc1)Nc1nnc(N2CCCC2)s1 |
| InChI | InChI=1S/C13H14ClN5OS/c14-9-3-5-10(6-4-9)15-11(20)16-12-17-18-13(21-12)19-7-1-2-8-19/h3-6H,1-2,7-8H2,(H2,15,16,17,20) |
| InChIKey | BRYYSGFMDRCYBG-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.81 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |