C14H16FN5OS — CID 20885174
1-(4-fluorophenyl)-3-(5-piperidin-1-yl-1,3,4-thiadiazol-2-yl)urea (PubChem CID 20885174) has the molecular formula C14H16FN5OS and a molecular weight of 321.38 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-3-(5-piperidin-1-yl-1,3,4-thiadiazol-2-yl)urea.
| Compound Name | 1-(4-fluorophenyl)-3-(5-piperidin-1-yl-1,3,4-thiadiazol-2-yl)urea |
|---|---|
| PubChem CID | 20885174 |
| Molecular Formula | C14H16FN5OS |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | 1-(4-fluorophenyl)-3-(5-piperidin-1-yl-1,3,4-thiadiazol-2-yl)urea |
| SMILES | O=C(Nc1ccc(F)cc1)Nc1nnc(N2CCCCC2)s1 |
| InChI | InChI=1S/C14H16FN5OS/c15-10-4-6-11(7-5-10)16-12(21)17-13-18-19-14(22-13)20-8-2-1-3-9-20/h4-7H,1-3,8-9H2,(H2,16,17,18,21) |
| InChIKey | GBACVOKDFBHGIQ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |