C17H23N5OS — CID 22509940
1-[5-(azepan-1-yl)-1,3,4-thiadiazol-2-yl]-3-(2,5-dimethylphenyl)urea (PubChem CID 22509940) has the molecular formula C17H23N5OS and a molecular weight of 345.47 g/mol. Its IUPAC name is 1-[5-(azepan-1-yl)-1,3,4-thiadiazol-2-yl]-3-(2,5-dimethylphenyl)urea.
| Compound Name | 1-[5-(azepan-1-yl)-1,3,4-thiadiazol-2-yl]-3-(2,5-dimethylphenyl)urea |
|---|---|
| PubChem CID | 22509940 |
| Molecular Formula | C17H23N5OS |
| Molecular Weight | 345.47 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | 1-[5-(azepan-1-yl)-1,3,4-thiadiazol-2-yl]-3-(2,5-dimethylphenyl)urea |
| SMILES | Cc1ccc(C)c(NC(=O)Nc2nnc(N3CCCCCC3)s2)c1 |
| InChI | InChI=1S/C17H23N5OS/c1-12-7-8-13(2)14(11-12)18-15(23)19-16-20-21-17(24-16)22-9-5-3-4-6-10-22/h7-8,11H,3-6,9-10H2,1-2H3,(H2,18,19,20,23) |
| InChIKey | SUZZCAJDZLQRJZ-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.47 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |