C16H21N5O2S — CID 22510522
1-(2-ethoxyphenyl)-3-(5-piperidin-1-yl-1,3,4-thiadiazol-2-yl)urea (PubChem CID 22510522) has the molecular formula C16H21N5O2S and a molecular weight of 347.44 g/mol. Its IUPAC name is 1-(2-ethoxyphenyl)-3-(5-piperidin-1-yl-1,3,4-thiadiazol-2-yl)urea.
| Compound Name | 1-(2-ethoxyphenyl)-3-(5-piperidin-1-yl-1,3,4-thiadiazol-2-yl)urea |
|---|---|
| PubChem CID | 22510522 |
| Molecular Formula | C16H21N5O2S |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | 1-(2-ethoxyphenyl)-3-(5-piperidin-1-yl-1,3,4-thiadiazol-2-yl)urea |
| SMILES | CCOc1ccccc1NC(=O)Nc1nnc(N2CCCCC2)s1 |
| InChI | InChI=1S/C16H21N5O2S/c1-2-23-13-9-5-4-8-12(13)17-14(22)18-15-19-20-16(24-15)21-10-6-3-7-11-21/h4-5,8-9H,2-3,6-7,10-11H2,1H3,(H2,17,18,19,22) |
| InChIKey | XRCDSCBMYWEBMF-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |