C21H24N4O2S — CID 23609690
1-[1-(1,3-benzothiazol-2-yl)piperidin-4-yl]-3-(2-ethoxyphenyl)urea (PubChem CID 23609690) has the molecular formula C21H24N4O2S and a molecular weight of 396.52 g/mol. Its IUPAC name is 1-[1-(1,3-benzothiazol-2-yl)piperidin-4-yl]-3-(2-ethoxyphenyl)urea.
| Compound Name | 1-[1-(1,3-benzothiazol-2-yl)piperidin-4-yl]-3-(2-ethoxyphenyl)urea |
|---|---|
| PubChem CID | 23609690 |
| Molecular Formula | C21H24N4O2S |
| Molecular Weight | 396.52 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | 1-[1-(1,3-benzothiazol-2-yl)piperidin-4-yl]-3-(2-ethoxyphenyl)urea |
| SMILES | CCOc1ccccc1NC(=O)NC1CCN(c2nc3ccccc3s2)CC1 |
| InChI | InChI=1S/C21H24N4O2S/c1-2-27-18-9-5-3-7-16(18)23-20(26)22-15-11-13-25(14-12-15)21-24-17-8-4-6-10-19(17)28-21/h3-10,15H,2,11-14H2,1H3,(H2,22,23,26) |
| InChIKey | GIFKSSCJWFBVRK-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.52 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |