C12H11FN4O3S2 — CID 7587032
(2S)-2-[[5-[(4-fluorophenyl)carbamoylamino]-1,3,4-thiadiazol-2-yl]sulfanyl]propanoic acid (PubChem CID 7587032) has the molecular formula C12H11FN4O3S2 and a molecular weight of 342.38 g/mol. Its IUPAC name is (2S)-2-[[5-[(4-fluorophenyl)carbamoylamino]-1,3,4-thiadiazol-2-yl]sulfanyl]propanoic acid.
| Compound Name | (2S)-2-[[5-[(4-fluorophenyl)carbamoylamino]-1,3,4-thiadiazol-2-yl]sulfanyl]propanoic acid |
|---|---|
| PubChem CID | 7587032 |
| Molecular Formula | C12H11FN4O3S2 |
| Molecular Weight | 342.38 g/mol |
| Exact Mass | 342.03 |
| IUPAC Name | (2S)-2-[[5-[(4-fluorophenyl)carbamoylamino]-1,3,4-thiadiazol-2-yl]sulfanyl]propanoic acid |
| SMILES | C[C@H](Sc1nnc(NC(=O)Nc2ccc(F)cc2)s1)C(=O)O |
| InChI | InChI=1S/C12H11FN4O3S2/c1-6(9(18)19)21-12-17-16-11(22-12)15-10(20)14-8-4-2-7(13)3-5-8/h2-6H,1H3,(H,18,19)(H2,14,15,16,20)/t6-/m0/s1 |
| InChIKey | YEEGBMBCHPOMQU-LURJTMIESA-N |
| XLogP | 2.89 |
| TPSA | 104.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.38 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|