C15H19ClN5OS2+ — CID 7587518
1-(4-chlorophenyl)-3-[5-(2-pyrrolidin-1-ium-1-ylethylsulfanyl)-1,3,4-thiadiazol-2-yl]urea (PubChem CID 7587518) has the molecular formula C15H19ClN5OS2+ and a molecular weight of 384.94 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-[5-(2-pyrrolidin-1-ium-1-ylethylsulfanyl)-1,3,4-thiadiazol-2-yl]urea.
| Compound Name | 1-(4-chlorophenyl)-3-[5-(2-pyrrolidin-1-ium-1-ylethylsulfanyl)-1,3,4-thiadiazol-2-yl]urea |
|---|---|
| PubChem CID | 7587518 |
| Molecular Formula | C15H19ClN5OS2+ |
| Molecular Weight | 384.94 g/mol |
| Exact Mass | 384.07 |
| IUPAC Name | 1-(4-chlorophenyl)-3-[5-(2-pyrrolidin-1-ium-1-ylethylsulfanyl)-1,3,4-thiadiazol-2-yl]urea |
| SMILES | O=C(Nc1ccc(Cl)cc1)Nc1nnc(SCC[NH+]2CCCC2)s1 |
| InChI | InChI=1S/C15H18ClN5OS2/c16-11-3-5-12(6-4-11)17-13(22)18-14-19-20-15(24-14)23-10-9-21-7-1-2-8-21/h3-6H,1-2,7-10H2,(H2,17,18,19,22)/p+1 |
| InChIKey | MWNGHBPNPVUPRH-UHFFFAOYSA-O |
| XLogP | 2.61 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.94 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|