C16H18Cl2N4O3S2 — CID 110190025
3-(3,5-dichlorophenyl)-1-[5-[2-(1,3-dioxan-2-yl)ethylsulfanyl]-1,3,4-thiadiazol-2-yl]-1-methylurea (PubChem CID 110190025) has the molecular formula C16H18Cl2N4O3S2 and a molecular weight of 449.39 g/mol. Its IUPAC name is 3-(3,5-dichlorophenyl)-1-[5-[2-(1,3-dioxan-2-yl)ethylsulfanyl]-1,3,4-thiadiazol-2-yl]-1-methylurea.
| Compound Name | 3-(3,5-dichlorophenyl)-1-[5-[2-(1,3-dioxan-2-yl)ethylsulfanyl]-1,3,4-thiadiazol-2-yl]-1-methylurea |
|---|---|
| PubChem CID | 110190025 |
| Molecular Formula | C16H18Cl2N4O3S2 |
| Molecular Weight | 449.39 g/mol |
| Exact Mass | 448.02 |
| IUPAC Name | 3-(3,5-dichlorophenyl)-1-[5-[2-(1,3-dioxan-2-yl)ethylsulfanyl]-1,3,4-thiadiazol-2-yl]-1-methylurea |
| SMILES | CN(C(=O)Nc1cc(Cl)cc(Cl)c1)c1nnc(SCCC2OCCCO2)s1 |
| InChI | InChI=1S/C16H18Cl2N4O3S2/c1-22(14(23)19-12-8-10(17)7-11(18)9-12)15-20-21-16(27-15)26-6-3-13-24-4-2-5-25-13/h7-9,13H,2-6H2,1H3,(H,19,23) |
| InChIKey | NLTXVFVOWODDEU-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.39 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|