C13H17Cl2N3O2 — CID 107654250
3-(3,5-dichlorophenyl)-1-methyl-1-(morpholin-2-ylmethyl)urea (PubChem CID 107654250) has the molecular formula C13H17Cl2N3O2 and a molecular weight of 318.20 g/mol. Its IUPAC name is 3-(3,5-dichlorophenyl)-1-methyl-1-(morpholin-2-ylmethyl)urea.
| Compound Name | 3-(3,5-dichlorophenyl)-1-methyl-1-(morpholin-2-ylmethyl)urea |
|---|---|
| PubChem CID | 107654250 |
| Molecular Formula | C13H17Cl2N3O2 |
| Molecular Weight | 318.20 g/mol |
| Exact Mass | 317.07 |
| IUPAC Name | 3-(3,5-dichlorophenyl)-1-methyl-1-(morpholin-2-ylmethyl)urea |
| SMILES | CN(CC1CNCCO1)C(=O)Nc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C13H17Cl2N3O2/c1-18(8-12-7-16-2-3-20-12)13(19)17-11-5-9(14)4-10(15)6-11/h4-6,12,16H,2-3,7-8H2,1H3,(H,17,19) |
| InChIKey | TZVLOXFXDDSPRM-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.20 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |