C8H14F2N2O2 — CID 103514255
2,2-difluoro-N-methyl-N-(morpholin-2-ylmethyl)acetamide (PubChem CID 103514255) has the molecular formula C8H14F2N2O2 and a molecular weight of 208.21 g/mol. Its IUPAC name is 2,2-difluoro-N-methyl-N-(morpholin-2-ylmethyl)acetamide.
| Compound Name | 2,2-difluoro-N-methyl-N-(morpholin-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 103514255 |
| Molecular Formula | C8H14F2N2O2 |
| Molecular Weight | 208.21 g/mol |
| Exact Mass | 208.10 |
| IUPAC Name | 2,2-difluoro-N-methyl-N-(morpholin-2-ylmethyl)acetamide |
| SMILES | CN(CC1CNCCO1)C(=O)C(F)F |
| InChI | InChI=1S/C8H14F2N2O2/c1-12(8(13)7(9)10)5-6-4-11-2-3-14-6/h6-7,11H,2-5H2,1H3 |
| InChIKey | SUSRJCIPTHXQRS-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.21 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |