C13H18N2O4 — CID 107690397
2,6-dihydroxy-N-methyl-N-(morpholin-2-ylmethyl)benzamide (PubChem CID 107690397) has the molecular formula C13H18N2O4 and a molecular weight of 266.30 g/mol. Its IUPAC name is 2,6-dihydroxy-N-methyl-N-(morpholin-2-ylmethyl)benzamide.
| Compound Name | 2,6-dihydroxy-N-methyl-N-(morpholin-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 107690397 |
| Molecular Formula | C13H18N2O4 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | 2,6-dihydroxy-N-methyl-N-(morpholin-2-ylmethyl)benzamide |
| SMILES | CN(CC1CNCCO1)C(=O)c1c(O)cccc1O |
| InChI | InChI=1S/C13H18N2O4/c1-15(8-9-7-14-5-6-19-9)13(18)12-10(16)3-2-4-11(12)17/h2-4,9,14,16-17H,5-8H2,1H3 |
| InChIKey | SUVWNSVKFOVHEN-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 82.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |