C14H18ClFN2O2 — CID 117045049
2-chloro-5-fluoro-N,4-dimethyl-N-(morpholin-2-ylmethyl)benzamide (PubChem CID 117045049) has the molecular formula C14H18ClFN2O2 and a molecular weight of 300.76 g/mol. Its IUPAC name is 2-chloro-5-fluoro-N,4-dimethyl-N-(morpholin-2-ylmethyl)benzamide.
| Compound Name | 2-chloro-5-fluoro-N,4-dimethyl-N-(morpholin-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 117045049 |
| Molecular Formula | C14H18ClFN2O2 |
| Molecular Weight | 300.76 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | 2-chloro-5-fluoro-N,4-dimethyl-N-(morpholin-2-ylmethyl)benzamide |
| SMILES | Cc1cc(Cl)c(C(=O)N(C)CC2CNCCO2)cc1F |
| InChI | InChI=1S/C14H18ClFN2O2/c1-9-5-12(15)11(6-13(9)16)14(19)18(2)8-10-7-17-3-4-20-10/h5-6,10,17H,3-4,7-8H2,1-2H3 |
| InChIKey | IHGRQNFWJHKOBP-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.76 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |