C13H18ClFN2O — CID 117045006
2-chloro-5-fluoro-N,4-dimethyl-N-[3-(methylamino)propyl]benzamide (PubChem CID 117045006) has the molecular formula C13H18ClFN2O and a molecular weight of 272.75 g/mol. Its IUPAC name is 2-chloro-5-fluoro-N,4-dimethyl-N-[3-(methylamino)propyl]benzamide.
| Compound Name | 2-chloro-5-fluoro-N,4-dimethyl-N-[3-(methylamino)propyl]benzamide |
|---|---|
| PubChem CID | 117045006 |
| Molecular Formula | C13H18ClFN2O |
| Molecular Weight | 272.75 g/mol |
| Exact Mass | 272.11 |
| IUPAC Name | 2-chloro-5-fluoro-N,4-dimethyl-N-[3-(methylamino)propyl]benzamide |
| SMILES | CNCCCN(C)C(=O)c1cc(F)c(C)cc1Cl |
| InChI | InChI=1S/C13H18ClFN2O/c1-9-7-11(14)10(8-12(9)15)13(18)17(3)6-4-5-16-2/h7-8,16H,4-6H2,1-3H3 |
| InChIKey | SSXJDTZKXJVTHR-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.75 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|