C12H15ClN2O3 — CID 3723720
3-(4-chlorophenyl)-1-(1,3-dioxolan-2-ylmethyl)-1-methylurea (PubChem CID 3723720) has the molecular formula C12H15ClN2O3 and a molecular weight of 270.72 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-1-(1,3-dioxolan-2-ylmethyl)-1-methylurea.
| Compound Name | 3-(4-chlorophenyl)-1-(1,3-dioxolan-2-ylmethyl)-1-methylurea |
|---|---|
| PubChem CID | 3723720 |
| Molecular Formula | C12H15ClN2O3 |
| Molecular Weight | 270.72 g/mol |
| Exact Mass | 270.08 |
| IUPAC Name | 3-(4-chlorophenyl)-1-(1,3-dioxolan-2-ylmethyl)-1-methylurea |
| SMILES | CN(CC1OCCO1)C(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H15ClN2O3/c1-15(8-11-17-6-7-18-11)12(16)14-10-4-2-9(13)3-5-10/h2-5,11H,6-8H2,1H3,(H,14,16) |
| InChIKey | PJCORZQEAQZDSP-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.72 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |