C13H17N5OS2 — CID 63738165
N-(2-aminophenyl)-3-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]propanamide (PubChem CID 63738165) has the molecular formula C13H17N5OS2 and a molecular weight of 323.45 g/mol. Its IUPAC name is N-(2-aminophenyl)-3-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]propanamide.
| Compound Name | N-(2-aminophenyl)-3-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]propanamide |
|---|---|
| PubChem CID | 63738165 |
| Molecular Formula | C13H17N5OS2 |
| Molecular Weight | 323.45 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | N-(2-aminophenyl)-3-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]propanamide |
| SMILES | CN(C)c1nnc(SCCC(=O)Nc2ccccc2N)s1 |
| InChI | InChI=1S/C13H17N5OS2/c1-18(2)12-16-17-13(21-12)20-8-7-11(19)15-10-6-4-3-5-9(10)14/h3-6H,7-8,14H2,1-2H3,(H,15,19) |
| InChIKey | YWGCWPKTFKZVGR-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.45 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|