About methyl 3-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]propanoate
methyl 3-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]propanoate (PubChem CID 63737450) has the molecular formula C8H13N3O2S2
and a molecular weight of 247.34 g/mol. Its IUPAC name is methyl 3-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]propanoate.
Molecular Properties
| Compound Name | methyl 3-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]propanoate |
| PubChem CID | 63737450 |
| Molecular Formula | C8H13N3O2S2 |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.04 |
| IUPAC Name | methyl 3-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]propanoate |
| SMILES | COC(=O)CCSc1nnc(N(C)C)s1 |
| InChI | InChI=1S/C8H13N3O2S2/c1-11(2)7-9-10-8(15-7)14-5-4-6(12)13-3/h4-5H2,1-3H3 |
| InChIKey | OCIVQCKMDQMGPD-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze methyl 3-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]propanoate?
The IUPAC name of methyl 3-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]propanoate (CID 63737450) is methyl 3-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]propanoate.
What is the SMILES notation for methyl 3-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]propanoate?
The canonical SMILES for methyl 3-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]propanoate is COC(=O)CCSc1nnc(N(C)C)s1.
What is the InChIKey of methyl 3-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]propanoate?
The InChIKey is OCIVQCKMDQMGPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3O2S2/c1-11(2)7-9-10-8(15-7)14-5-4-6(12)13-3/h4-5H2,1-3H3.
What are the key properties of methyl 3-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]propanoate?
methyl 3-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]propanoate has a molecular weight of 247.34 g/mol, XLogP of 1.26, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]propanoate is sourced from PubChem (CID 63737450), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).