C8H12BrN3O2S2 — CID 81091198
methyl 2-bromo-3-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]propanoate (PubChem CID 81091198) has the molecular formula C8H12BrN3O2S2 and a molecular weight of 326.24 g/mol. Its IUPAC name is methyl 2-bromo-3-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]propanoate.
| Compound Name | methyl 2-bromo-3-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]propanoate |
|---|---|
| PubChem CID | 81091198 |
| Molecular Formula | C8H12BrN3O2S2 |
| Molecular Weight | 326.24 g/mol |
| Exact Mass | 324.96 |
| IUPAC Name | methyl 2-bromo-3-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]propanoate |
| SMILES | COC(=O)C(Br)CSc1nnc(N(C)C)s1 |
| InChI | InChI=1S/C8H12BrN3O2S2/c1-12(2)7-10-11-8(16-7)15-4-5(9)6(13)14-3/h5H,4H2,1-3H3 |
| InChIKey | WRRZZWYIEWSXHA-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.24 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|