C12H21N3O2S2 — CID 106714499
6-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-2,2-dimethylhexanoic acid (PubChem CID 106714499) has the molecular formula C12H21N3O2S2 and a molecular weight of 303.45 g/mol. Its IUPAC name is 6-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-2,2-dimethylhexanoic acid.
| Compound Name | 6-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-2,2-dimethylhexanoic acid |
|---|---|
| PubChem CID | 106714499 |
| Molecular Formula | C12H21N3O2S2 |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | 6-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-2,2-dimethylhexanoic acid |
| SMILES | CN(C)c1nnc(SCCCCC(C)(C)C(=O)O)s1 |
| InChI | InChI=1S/C12H21N3O2S2/c1-12(2,9(16)17)7-5-6-8-18-11-14-13-10(19-11)15(3)4/h5-8H2,1-4H3,(H,16,17) |
| InChIKey | DHEXKJBFIKJVQU-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 66.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|