C10H18N4OS2 — CID 54497622
1-(5-butylsulfanyl-1,3,4-thiadiazol-2-yl)-1,3,3-trimethylurea (PubChem CID 54497622) has the molecular formula C10H18N4OS2 and a molecular weight of 274.41 g/mol. Its IUPAC name is 1-(5-butylsulfanyl-1,3,4-thiadiazol-2-yl)-1,3,3-trimethylurea.
| Compound Name | 1-(5-butylsulfanyl-1,3,4-thiadiazol-2-yl)-1,3,3-trimethylurea |
|---|---|
| PubChem CID | 54497622 |
| Molecular Formula | C10H18N4OS2 |
| Molecular Weight | 274.41 g/mol |
| Exact Mass | 274.09 |
| IUPAC Name | 1-(5-butylsulfanyl-1,3,4-thiadiazol-2-yl)-1,3,3-trimethylurea |
| SMILES | CCCCSc1nnc(N(C)C(=O)N(C)C)s1 |
| InChI | InChI=1S/C10H18N4OS2/c1-5-6-7-16-9-12-11-8(17-9)14(4)10(15)13(2)3/h5-7H2,1-4H3 |
| InChIKey | YAFRZTCVUQQSEH-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.41 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|