C15H28N2OS3 — CID 4689343
(5-dodecylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanylmethanol (PubChem CID 4689343) has the molecular formula C15H28N2OS3 and a molecular weight of 348.60 g/mol. Its IUPAC name is (5-dodecylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanylmethanol.
| Compound Name | (5-dodecylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanylmethanol |
|---|---|
| PubChem CID | 4689343 |
| Molecular Formula | C15H28N2OS3 |
| Molecular Weight | 348.60 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | (5-dodecylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanylmethanol |
| SMILES | CCCCCCCCCCCCSc1nnc(SCO)s1 |
| InChI | InChI=1S/C15H28N2OS3/c1-2-3-4-5-6-7-8-9-10-11-12-19-14-16-17-15(21-14)20-13-18/h18H,2-13H2,1H3 |
| InChIKey | WYJXGHSRQRZUDR-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.60 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|