About (5-dodecylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanylmethanol
(5-dodecylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanylmethanol (PubChem CID 4689343) has the molecular formula C15H28N2OS3
and a molecular weight of 348.60 g/mol. Its IUPAC name is (5-dodecylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanylmethanol.
Molecular Properties
| Compound Name | (5-dodecylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanylmethanol |
| PubChem CID | 4689343 |
| Molecular Formula | C15H28N2OS3 |
| Molecular Weight | 348.60 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | (5-dodecylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanylmethanol |
| SMILES | CCCCCCCCCCCCSc1nnc(SCO)s1 |
| InChI | InChI=1S/C15H28N2OS3/c1-2-3-4-5-6-7-8-9-10-11-12-19-14-16-17-15(21-14)20-13-18/h18H,2-13H2,1H3 |
| InChIKey | WYJXGHSRQRZUDR-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 348.60 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze (5-dodecylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanylmethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-dodecylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanylmethanol?
The IUPAC name of (5-dodecylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanylmethanol (CID 4689343) is (5-dodecylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanylmethanol.
What is the SMILES notation for (5-dodecylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanylmethanol?
The canonical SMILES for (5-dodecylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanylmethanol is CCCCCCCCCCCCSc1nnc(SCO)s1.
What is the InChIKey of (5-dodecylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanylmethanol?
The InChIKey is WYJXGHSRQRZUDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H28N2OS3/c1-2-3-4-5-6-7-8-9-10-11-12-19-14-16-17-15(21-14)20-13-18/h18H,2-13H2,1H3.
What are the key properties of (5-dodecylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanylmethanol?
(5-dodecylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanylmethanol has a molecular weight of 348.60 g/mol, XLogP of 5.59, 14 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (5-dodecylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanylmethanol is sourced from PubChem (CID 4689343), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).