C12H21N3O2S3 — CID 47111449
2-[(5-butylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]-N-(1-methoxypropan-2-yl)acetamide (PubChem CID 47111449) has the molecular formula C12H21N3O2S3 and a molecular weight of 335.52 g/mol. Its IUPAC name is 2-[(5-butylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]-N-(1-methoxypropan-2-yl)acetamide.
| Compound Name | 2-[(5-butylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]-N-(1-methoxypropan-2-yl)acetamide |
|---|---|
| PubChem CID | 47111449 |
| Molecular Formula | C12H21N3O2S3 |
| Molecular Weight | 335.52 g/mol |
| Exact Mass | 335.08 |
| IUPAC Name | 2-[(5-butylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]-N-(1-methoxypropan-2-yl)acetamide |
| SMILES | CCCCSc1nnc(SCC(=O)NC(C)COC)s1 |
| InChI | InChI=1S/C12H21N3O2S3/c1-4-5-6-18-11-14-15-12(20-11)19-8-10(16)13-9(2)7-17-3/h9H,4-8H2,1-3H3,(H,13,16) |
| InChIKey | WOABPGJHWNMMLF-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.52 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|