C12H20N4O2S3 — CID 17404735
2-[(5-butylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]-N-carbamoyl-3-methylbutanamide (PubChem CID 17404735) has the molecular formula C12H20N4O2S3 and a molecular weight of 348.52 g/mol. Its IUPAC name is 2-[(5-butylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]-N-carbamoyl-3-methylbutanamide.
| Compound Name | 2-[(5-butylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]-N-carbamoyl-3-methylbutanamide |
|---|---|
| PubChem CID | 17404735 |
| Molecular Formula | C12H20N4O2S3 |
| Molecular Weight | 348.52 g/mol |
| Exact Mass | 348.07 |
| IUPAC Name | 2-[(5-butylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]-N-carbamoyl-3-methylbutanamide |
| SMILES | CCCCSc1nnc(SC(C(=O)NC(N)=O)C(C)C)s1 |
| InChI | InChI=1S/C12H20N4O2S3/c1-4-5-6-19-11-15-16-12(21-11)20-8(7(2)3)9(17)14-10(13)18/h7-8H,4-6H2,1-3H3,(H3,13,14,17,18) |
| InChIKey | XCAGBQKAKZVWLQ-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.52 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|