C14H26N2S3 — CID 2818227
5-dodecylsulfanyl-3H-1,3,4-thiadiazole-2-thione (PubChem CID 2818227) has the molecular formula C14H26N2S3 and a molecular weight of 318.58 g/mol. Its IUPAC name is 5-dodecylsulfanyl-3H-1,3,4-thiadiazole-2-thione.
| Compound Name | 5-dodecylsulfanyl-3H-1,3,4-thiadiazole-2-thione |
|---|---|
| PubChem CID | 2818227 |
| Molecular Formula | C14H26N2S3 |
| Molecular Weight | 318.58 g/mol |
| Exact Mass | 318.13 |
| IUPAC Name | 5-dodecylsulfanyl-3H-1,3,4-thiadiazole-2-thione |
| SMILES | CCCCCCCCCCCCSc1n[nH]c(=S)s1 |
| InChI | InChI=1S/C14H26N2S3/c1-2-3-4-5-6-7-8-9-10-11-12-18-14-16-15-13(17)19-14/h2-12H2,1H3,(H,15,17) |
| InChIKey | WSYQMMUOSGMAAH-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.58 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|