C12H20N4S6 — CID 159807202
5-butylsulfanyl-3H-1,3,4-thiadiazole-2-thione (PubChem CID 159807202) has the molecular formula C12H20N4S6 and a molecular weight of 412.72 g/mol. Its IUPAC name is 5-butylsulfanyl-3H-1,3,4-thiadiazole-2-thione.
| Compound Name | 5-butylsulfanyl-3H-1,3,4-thiadiazole-2-thione |
|---|---|
| PubChem CID | 159807202 |
| Molecular Formula | C12H20N4S6 |
| Molecular Weight | 412.72 g/mol |
| Exact Mass | 412.00 |
| IUPAC Name | 5-butylsulfanyl-3H-1,3,4-thiadiazole-2-thione |
| SMILES | CCCCSc1n[nH]c(=S)s1.CCCCSc1n[nH]c(=S)s1 |
| InChI | InChI=1S/2C6H10N2S3/c2*1-2-3-4-10-6-8-7-5(9)11-6/h2*2-4H2,1H3,(H,7,9) |
| InChIKey | NKOAAXASAIGLBD-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.72 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|