C16H26N2O2S3 — CID 139686748
10-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)sulfanyl]decyl 2-methylprop-2-enoate (PubChem CID 139686748) has the molecular formula C16H26N2O2S3 and a molecular weight of 374.60 g/mol. Its IUPAC name is 10-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)sulfanyl]decyl 2-methylprop-2-enoate.
| Compound Name | 10-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)sulfanyl]decyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 139686748 |
| Molecular Formula | C16H26N2O2S3 |
| Molecular Weight | 374.60 g/mol |
| Exact Mass | 374.12 |
| IUPAC Name | 10-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)sulfanyl]decyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCCCCCCCCSc1n[nH]c(=S)s1 |
| InChI | InChI=1S/C16H26N2O2S3/c1-13(2)14(19)20-11-9-7-5-3-4-6-8-10-12-22-16-18-17-15(21)23-16/h1,3-12H2,2H3,(H,17,21) |
| InChIKey | HAMYFDMSHSOHLV-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.60 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|