C15H28O2S — CID 165355535
4-heptylsulfanylbutyl 2-methylprop-2-enoate (PubChem CID 165355535) has the molecular formula C15H28O2S and a molecular weight of 272.45 g/mol. Its IUPAC name is 4-heptylsulfanylbutyl 2-methylprop-2-enoate.
| Compound Name | 4-heptylsulfanylbutyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 165355535 |
| Molecular Formula | C15H28O2S |
| Molecular Weight | 272.45 g/mol |
| Exact Mass | 272.18 |
| IUPAC Name | 4-heptylsulfanylbutyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCCSCCCCCCC |
| InChI | InChI=1S/C15H28O2S/c1-4-5-6-7-9-12-18-13-10-8-11-17-15(16)14(2)3/h2,4-13H2,1,3H3 |
| InChIKey | DADULGCKIKZVRQ-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.45 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|