C4H6N2OS3 — CID 166046358
5-(methoxymethylsulfanyl)-3H-1,3,4-thiadiazole-2-thione (PubChem CID 166046358) has the molecular formula C4H6N2OS3 and a molecular weight of 194.31 g/mol. Its IUPAC name is 5-(methoxymethylsulfanyl)-3H-1,3,4-thiadiazole-2-thione.
| Compound Name | 5-(methoxymethylsulfanyl)-3H-1,3,4-thiadiazole-2-thione |
|---|---|
| PubChem CID | 166046358 |
| Molecular Formula | C4H6N2OS3 |
| Molecular Weight | 194.31 g/mol |
| Exact Mass | 193.96 |
| IUPAC Name | 5-(methoxymethylsulfanyl)-3H-1,3,4-thiadiazole-2-thione |
| SMILES | COCSc1n[nH]c(=S)s1 |
| InChI | InChI=1S/C4H6N2OS3/c1-7-2-9-4-6-5-3(8)10-4/h2H2,1H3,(H,5,8) |
| InChIKey | MTNLIXRBDVGSBB-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.31 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|