C10H10N2S4 — CID 139671641
5-[(4-methylsulfanylphenyl)methylsulfanyl]-3H-1,3,4-thiadiazole-2-thione (PubChem CID 139671641) has the molecular formula C10H10N2S4 and a molecular weight of 286.47 g/mol. Its IUPAC name is 5-[(4-methylsulfanylphenyl)methylsulfanyl]-3H-1,3,4-thiadiazole-2-thione.
| Compound Name | 5-[(4-methylsulfanylphenyl)methylsulfanyl]-3H-1,3,4-thiadiazole-2-thione |
|---|---|
| PubChem CID | 139671641 |
| Molecular Formula | C10H10N2S4 |
| Molecular Weight | 286.47 g/mol |
| Exact Mass | 285.97 |
| IUPAC Name | 5-[(4-methylsulfanylphenyl)methylsulfanyl]-3H-1,3,4-thiadiazole-2-thione |
| SMILES | CSc1ccc(CSc2n[nH]c(=S)s2)cc1 |
| InChI | InChI=1S/C10H10N2S4/c1-14-8-4-2-7(3-5-8)6-15-10-12-11-9(13)16-10/h2-5H,6H2,1H3,(H,11,13) |
| InChIKey | GUGXASDNQFUAHK-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.47 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|