C6H8N4S6 — CID 170572399
ethane;5-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)disulfanyl]-3H-1,3,4-thiadiazole-2-thione (PubChem CID 170572399) has the molecular formula C6H8N4S6 and a molecular weight of 328.56 g/mol. Its IUPAC name is ethane;5-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)disulfanyl]-3H-1,3,4-thiadiazole-2-thione.
| Compound Name | ethane;5-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)disulfanyl]-3H-1,3,4-thiadiazole-2-thione |
|---|---|
| PubChem CID | 170572399 |
| Molecular Formula | C6H8N4S6 |
| Molecular Weight | 328.56 g/mol |
| Exact Mass | 327.91 |
| IUPAC Name | ethane;5-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)disulfanyl]-3H-1,3,4-thiadiazole-2-thione |
| SMILES | CC.S=c1[nH]nc(SSc2n[nH]c(=S)s2)s1 |
| InChI | InChI=1S/C4H2N4S6.C2H6/c9-1-5-7-3(11-1)13-14-4-8-6-2(10)12-4;1-2/h(H,5,9)(H,6,10);1-2H3 |
| InChIKey | XMEMEABBILNERH-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.56 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|