C7H12N2S3 — CID 18711572
5-pentan-3-ylsulfanyl-3H-1,3,4-thiadiazole-2-thione (PubChem CID 18711572) has the molecular formula C7H12N2S3 and a molecular weight of 220.39 g/mol. Its IUPAC name is 5-pentan-3-ylsulfanyl-3H-1,3,4-thiadiazole-2-thione.
| Compound Name | 5-pentan-3-ylsulfanyl-3H-1,3,4-thiadiazole-2-thione |
|---|---|
| PubChem CID | 18711572 |
| Molecular Formula | C7H12N2S3 |
| Molecular Weight | 220.39 g/mol |
| Exact Mass | 220.02 |
| IUPAC Name | 5-pentan-3-ylsulfanyl-3H-1,3,4-thiadiazole-2-thione |
| SMILES | CCC(CC)Sc1n[nH]c(=S)s1 |
| InChI | InChI=1S/C7H12N2S3/c1-3-5(4-2)11-7-9-8-6(10)12-7/h5H,3-4H2,1-2H3,(H,8,10) |
| InChIKey | VNJARDMVOSXASH-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.39 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|