C23H40N2O4S3 — CID 156870346
4-O-(2-ethylheptyl) 1-O-(2-ethylhexyl) 2-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)sulfanyl]butanedioate (PubChem CID 156870346) has the molecular formula C23H40N2O4S3 and a molecular weight of 504.78 g/mol. Its IUPAC name is 4-O-(2-ethylheptyl) 1-O-(2-ethylhexyl) 2-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)sulfanyl]butanedioate.
| Compound Name | 4-O-(2-ethylheptyl) 1-O-(2-ethylhexyl) 2-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)sulfanyl]butanedioate |
|---|---|
| PubChem CID | 156870346 |
| Molecular Formula | C23H40N2O4S3 |
| Molecular Weight | 504.78 g/mol |
| Exact Mass | 504.22 |
| IUPAC Name | 4-O-(2-ethylheptyl) 1-O-(2-ethylhexyl) 2-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)sulfanyl]butanedioate |
| SMILES | CCCCCC(CC)COC(=O)CC(Sc1n[nH]c(=S)s1)C(=O)OCC(CC)CCCC |
| InChI | InChI=1S/C23H40N2O4S3/c1-5-9-11-13-18(8-4)15-28-20(26)14-19(31-23-25-24-22(30)32-23)21(27)29-16-17(7-3)12-10-6-2/h17-19H,5-16H2,1-4H3,(H,24,30) |
| InChIKey | QAMWZBANZHNWAM-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 81.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.78 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|