C14H23NO2S2 — CID 107018560
2-ethylhexyl 2-(4-methyl-2-sulfanylidene-3H-1,3-thiazol-5-yl)acetate (PubChem CID 107018560) has the molecular formula C14H23NO2S2 and a molecular weight of 301.48 g/mol. Its IUPAC name is 2-ethylhexyl 2-(4-methyl-2-sulfanylidene-3H-1,3-thiazol-5-yl)acetate.
| Compound Name | 2-ethylhexyl 2-(4-methyl-2-sulfanylidene-3H-1,3-thiazol-5-yl)acetate |
|---|---|
| PubChem CID | 107018560 |
| Molecular Formula | C14H23NO2S2 |
| Molecular Weight | 301.48 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | 2-ethylhexyl 2-(4-methyl-2-sulfanylidene-3H-1,3-thiazol-5-yl)acetate |
| SMILES | CCCCC(CC)COC(=O)Cc1sc(=S)[nH]c1C |
| InChI | InChI=1S/C14H23NO2S2/c1-4-6-7-11(5-2)9-17-13(16)8-12-10(3)15-14(18)19-12/h11H,4-9H2,1-3H3,(H,15,18) |
| InChIKey | JKGVMUOLDPVQFE-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.48 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|