About CID 88667856
CID 88667856 (PubChem CID 88667856) has the molecular formula C23H45O4Sn
and a molecular weight of 504.32 g/mol.
Molecular Properties
| Compound Name | CID 88667856 |
| PubChem CID | 88667856 |
| Molecular Formula | C23H45O4Sn |
| Molecular Weight | 504.32 g/mol |
| Exact Mass | 505.23 |
| IUPAC Name | — |
| SMILES | CCCCC(CC)COC(=O)CC[Sn](C)CCC(=O)OCC(CC)CCCC |
| InChI | InChI=1S/2C11H21O2.CH3.Sn/c2*1-4-7-8-10(5-2)9-13-11(12)6-3;;/h2*10H,3-9H2,1-2H3;1H3; |
| InChIKey | ZUGSGIYDNUYBOO-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 504.32 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze CID 88667856 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 88667856?
The IUPAC name of CID 88667856 (CID 88667856) is not available.
What is the SMILES notation for CID 88667856?
The canonical SMILES for CID 88667856 is CCCCC(CC)COC(=O)CC[Sn](C)CCC(=O)OCC(CC)CCCC.
What is the InChIKey of CID 88667856?
The InChIKey is ZUGSGIYDNUYBOO-UHFFFAOYSA-N. The full InChI is InChI=1S/2C11H21O2.CH3.Sn/c2*1-4-7-8-10(5-2)9-13-11(12)6-3;;/h2*10H,3-9H2,1-2H3;1H3;.
What are the key properties of CID 88667856?
CID 88667856 has a molecular weight of 504.32 g/mol, XLogP of 6.41, 18 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 88667856 is sourced from PubChem (CID 88667856), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).