C11H21N3OS2 — CID 60613691
5-[[5-(2-methylpropylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]pentan-1-ol (PubChem CID 60613691) has the molecular formula C11H21N3OS2 and a molecular weight of 275.44 g/mol. Its IUPAC name is 5-[[5-(2-methylpropylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]pentan-1-ol.
| Compound Name | 5-[[5-(2-methylpropylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]pentan-1-ol |
|---|---|
| PubChem CID | 60613691 |
| Molecular Formula | C11H21N3OS2 |
| Molecular Weight | 275.44 g/mol |
| Exact Mass | 275.11 |
| IUPAC Name | 5-[[5-(2-methylpropylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]pentan-1-ol |
| SMILES | CC(C)CNc1nnc(SCCCCCO)s1 |
| InChI | InChI=1S/C11H21N3OS2/c1-9(2)8-12-10-13-14-11(17-10)16-7-5-3-4-6-15/h9,15H,3-8H2,1-2H3,(H,12,13) |
| InChIKey | DVHUPTFYVXMSDI-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.44 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|