C11H15N3OS3 — CID 47130725
3-[[5-(2-thiophen-2-ylethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]propan-1-ol (PubChem CID 47130725) has the molecular formula C11H15N3OS3 and a molecular weight of 301.46 g/mol. Its IUPAC name is 3-[[5-(2-thiophen-2-ylethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]propan-1-ol.
| Compound Name | 3-[[5-(2-thiophen-2-ylethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]propan-1-ol |
|---|---|
| PubChem CID | 47130725 |
| Molecular Formula | C11H15N3OS3 |
| Molecular Weight | 301.46 g/mol |
| Exact Mass | 301.04 |
| IUPAC Name | 3-[[5-(2-thiophen-2-ylethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]propan-1-ol |
| SMILES | OCCCSc1nnc(NCCc2cccs2)s1 |
| InChI | InChI=1S/C11H15N3OS3/c15-6-2-8-17-11-14-13-10(18-11)12-5-4-9-3-1-7-16-9/h1,3,7,15H,2,4-6,8H2,(H,12,13) |
| InChIKey | UTICGBSSCQAVDN-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.46 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|