C14H16N4O2S3 — CID 35364013
1-[2-[[5-(2-thiophen-2-ylethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]ethyl]pyrrolidine-2,5-dione (PubChem CID 35364013) has the molecular formula C14H16N4O2S3 and a molecular weight of 368.51 g/mol. Its IUPAC name is 1-[2-[[5-(2-thiophen-2-ylethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]ethyl]pyrrolidine-2,5-dione.
| Compound Name | 1-[2-[[5-(2-thiophen-2-ylethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]ethyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 35364013 |
| Molecular Formula | C14H16N4O2S3 |
| Molecular Weight | 368.51 g/mol |
| Exact Mass | 368.04 |
| IUPAC Name | 1-[2-[[5-(2-thiophen-2-ylethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]ethyl]pyrrolidine-2,5-dione |
| SMILES | O=C1CCC(=O)N1CCSc1nnc(NCCc2cccs2)s1 |
| InChI | InChI=1S/C14H16N4O2S3/c19-11-3-4-12(20)18(11)7-9-22-14-17-16-13(23-14)15-6-5-10-2-1-8-21-10/h1-2,8H,3-7,9H2,(H,15,16) |
| InChIKey | TUEANUBHGSUNQX-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.51 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|