C12H13Cl2N3S3 — CID 26207414
5-[[(1S)-2,2-dichlorocyclopropyl]methylsulfanyl]-N-(2-thiophen-2-ylethyl)-1,3,4-thiadiazol-2-amine (PubChem CID 26207414) has the molecular formula C12H13Cl2N3S3 and a molecular weight of 366.36 g/mol. Its IUPAC name is 5-[[(1S)-2,2-dichlorocyclopropyl]methylsulfanyl]-N-(2-thiophen-2-ylethyl)-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-[[(1S)-2,2-dichlorocyclopropyl]methylsulfanyl]-N-(2-thiophen-2-ylethyl)-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 26207414 |
| Molecular Formula | C12H13Cl2N3S3 |
| Molecular Weight | 366.36 g/mol |
| Exact Mass | 364.96 |
| IUPAC Name | 5-[[(1S)-2,2-dichlorocyclopropyl]methylsulfanyl]-N-(2-thiophen-2-ylethyl)-1,3,4-thiadiazol-2-amine |
| SMILES | ClC1(Cl)C[C@H]1CSc1nnc(NCCc2cccs2)s1 |
| InChI | InChI=1S/C12H13Cl2N3S3/c13-12(14)6-8(12)7-19-11-17-16-10(20-11)15-4-3-9-2-1-5-18-9/h1-2,5,8H,3-4,6-7H2,(H,15,16)/t8-/m0/s1 |
| InChIKey | NVEYXRHVKDSHDU-QMMMGPOBSA-N |
| XLogP | 4.54 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.36 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|